C23H21N5O — CID 24931133
4-[7-[(5-phenyl-1,2-oxazol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline (PubChem CID 24931133) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-[7-[(5-phenyl-1,2-oxazol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[7-[(5-phenyl-1,2-oxazol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24931133 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-[7-[(5-phenyl-1,2-oxazol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CN(Cc2cc(-c4ccccc4)on2)CC3)cc1 |
| InChI | InChI=1S/C23H21N5O/c24-19-8-6-17(7-9-19)23-25-13-18-10-11-28(15-21(18)26-23)14-20-12-22(29-27-20)16-4-2-1-3-5-16/h1-9,12-13H,10-11,14-15,24H2 |
| InChIKey | VTCUKJOTYVTGRE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|