C24H26N8S — CID 135867819
2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,2,4-triazole-3-thione (PubChem CID 135867819) has the molecular formula C24H26N8S and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135867819 |
| Molecular Formula | C24H26N8S |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,2,4-triazole-3-thione |
| SMILES | CN1CCN(Cn2nc(-c3ccccc3)n(/N=C/c3cn[nH]c3-c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C24H26N8S/c1-29-12-14-30(15-13-29)18-31-24(33)32(23(28-31)20-10-6-3-7-11-20)26-17-21-16-25-27-22(21)19-8-4-2-5-9-19/h2-11,16-17H,12-15,18H2,1H3,(H,25,27)/b26-17+ |
| InChIKey | NUNHURIXEPUHGX-YZSQISJMSA-N |
| XLogP | 3.56 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|