C16H9ClN2O3 — CID 135867966
2-(2-chlorophenyl)-8-hydroxy-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 135867966) has the molecular formula C16H9ClN2O3 and a molecular weight of 312.71 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-8-hydroxy-3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(2-chlorophenyl)-8-hydroxy-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135867966 |
| Molecular Formula | C16H9ClN2O3 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(2-chlorophenyl)-8-hydroxy-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2Cl)nc2c1oc1ccc(O)cc12 |
| InChI | InChI=1S/C16H9ClN2O3/c17-11-4-2-1-3-9(11)15-18-13-10-7-8(20)5-6-12(10)22-14(13)16(21)19-15/h1-7,20H,(H,18,19,21) |
| InChIKey | PIQQGEFPKANVCP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |