C22H20BrN3O2S — CID 135869128
4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-(2-phenoxyethyl)-2H-pyrrol-3-ol (PubChem CID 135869128) has the molecular formula C22H20BrN3O2S and a molecular weight of 470.39 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-(2-phenoxyethyl)-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-(2-phenoxyethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135869128 |
| Molecular Formula | C22H20BrN3O2S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-(2-phenoxyethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Br)cc3)c(C)s2)=C(O)CN1CCOc1ccccc1 |
| InChI | InChI=1S/C22H20BrN3O2S/c1-14-20(15-7-9-16(23)10-8-15)25-22(29-14)19-18(27)13-26(21(19)24)11-12-28-17-5-3-2-4-6-17/h2-10,24,27H,11-13H2,1H3/b24-21- |
| InChIKey | CRLYZUOLTBAIHV-FLFQWRMESA-N |
| XLogP | 5.52 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|