C14H22N4O — CID 135869425
2-nonyl-5H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135869425) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-nonyl-5H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-nonyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135869425 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-nonyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCn1cc2c(=O)[nH]cnc2n1 |
| InChI | InChI=1S/C14H22N4O/c1-2-3-4-5-6-7-8-9-18-10-12-13(17-18)15-11-16-14(12)19/h10-11H,2-9H2,1H3,(H,15,16,17,19) |
| InChIKey | AYRZXXNKZTUZIK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|