About 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one
2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135869426) has the molecular formula C16H26N4O
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| PubChem CID | 135869426 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCCCn1cc2c(=O)[nH]cnc2n1 |
| InChI | InChI=1S/C16H26N4O/c1-2-3-4-5-6-7-8-9-10-11-20-12-14-15(19-20)17-13-18-16(14)21/h12-13H,2-11H2,1H3,(H,17,18,19,21) |
| InChIKey | YBHOTVLAXPSLHD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one (CID 135869426) is 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one is CCCCCCCCCCCn1cc2c(=O)[nH]cnc2n1.
What is the InChIKey of 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The InChIKey is YBHOTVLAXPSLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O/c1-2-3-4-5-6-7-8-9-10-11-20-12-14-15(19-20)17-13-18-16(14)21/h12-13H,2-11H2,1H3,(H,17,18,19,21).
What are the key properties of 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one has a molecular weight of 290.41 g/mol, XLogP of 3.65, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecyl-5H-pyrazolo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 135869426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).