C17H15N7O2S2 — CID 135870191
2-[(6-methyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 135870191) has the molecular formula C17H15N7O2S2 and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-[(6-methyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(6-methyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135870191 |
| Molecular Formula | C17H15N7O2S2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-[(6-methyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3nnc4[nH]c(=O)c(C)nn34)n2)cc1 |
| InChI | InChI=1S/C17H15N7O2S2/c1-9-3-5-11(6-4-9)12-7-27-16(18-12)19-13(25)8-28-17-22-21-15-20-14(26)10(2)23-24(15)17/h3-7H,8H2,1-2H3,(H,18,19,25)(H,20,21,26) |
| InChIKey | VTMGJINUXGVWJY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |