C18H16Cl2N4O2 — CID 135870537
4-[3-[2-(benzylamino)ethoxy]-1,2,4-triazin-6-yl]-2,6-dichlorophenol (PubChem CID 135870537) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-[3-[2-(benzylamino)ethoxy]-1,2,4-triazin-6-yl]-2,6-dichlorophenol.
| Compound Name | 4-[3-[2-(benzylamino)ethoxy]-1,2,4-triazin-6-yl]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 135870537 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-[3-[2-(benzylamino)ethoxy]-1,2,4-triazin-6-yl]-2,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(-c2cnc(OCCNCc3ccccc3)nn2)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N4O2/c19-14-8-13(9-15(20)17(14)25)16-11-22-18(24-23-16)26-7-6-21-10-12-4-2-1-3-5-12/h1-5,8-9,11,21,25H,6-7,10H2 |
| InChIKey | OXZPQMBBNIEAJV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|