C16H17N3O5 — CID 135871654
3-[3-(3-methoxy-4-prop-2-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 135871654) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-[3-(3-methoxy-4-prop-2-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[3-(3-methoxy-4-prop-2-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 135871654 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-[3-(3-methoxy-4-prop-2-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | C=CCOc1ccc(-c2nnc(CCC(=O)O)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C16H17N3O5/c1-3-8-24-12-6-4-10(9-13(12)23-2)15-17-16(22)11(18-19-15)5-7-14(20)21/h3-4,6,9H,1,5,7-8H2,2H3,(H,20,21)(H,17,19,22) |
| InChIKey | IBJBFTCCNFXWEW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|