C24H28N4O5 — CID 135872131
N-benzyl-3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide (PubChem CID 135872131) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-benzyl-3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide.
| Compound Name | N-benzyl-3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
|---|---|
| PubChem CID | 135872131 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-benzyl-3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| SMILES | CCOCCOc1ccc(-c2nnc(CCC(=O)NCc3ccccc3)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C24H28N4O5/c1-3-32-13-14-33-20-11-9-18(15-21(20)31-2)23-26-24(30)19(27-28-23)10-12-22(29)25-16-17-7-5-4-6-8-17/h4-9,11,15H,3,10,12-14,16H2,1-2H3,(H,25,29)(H,26,28,30) |
| InChIKey | VFFIXXLVEQTZQG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|