C24H35N5O5 — CID 135872135
3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide (PubChem CID 135872135) has the molecular formula C24H35N5O5 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide.
| Compound Name | 3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 135872135 |
| Molecular Formula | C24H35N5O5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 3-[3-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide |
| SMILES | CCOCCOc1ccc(-c2nnc(CCC(=O)NCCN3CCCCC3)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C24H35N5O5/c1-3-33-15-16-34-20-9-7-18(17-21(20)32-2)23-26-24(31)19(27-28-23)8-10-22(30)25-11-14-29-12-5-4-6-13-29/h7,9,17H,3-6,8,10-16H2,1-2H3,(H,25,30)(H,26,28,31) |
| InChIKey | ZAMPGQDBPNOGHY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|