C19H26N4O5 — CID 135859296
N-(2-methoxyethyl)-3-[3-(3-methoxy-4-propan-2-yloxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide (PubChem CID 135859296) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[3-(3-methoxy-4-propan-2-yloxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[3-(3-methoxy-4-propan-2-yloxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
|---|---|
| PubChem CID | 135859296 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(2-methoxyethyl)-3-[3-(3-methoxy-4-propan-2-yloxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| SMILES | COCCNC(=O)CCc1nnc(-c2ccc(OC(C)C)c(OC)c2)[nH]c1=O |
| InChI | InChI=1S/C19H26N4O5/c1-12(2)28-15-7-5-13(11-16(15)27-4)18-21-19(25)14(22-23-18)6-8-17(24)20-9-10-26-3/h5,7,11-12H,6,8-10H2,1-4H3,(H,20,24)(H,21,23,25) |
| InChIKey | RAOIGFPUBSKZCF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|