C23H25FN4O5 — CID 135872100
3-[3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 135872100) has the molecular formula C23H25FN4O5 and a molecular weight of 456.47 g/mol. Its IUPAC name is 3-[3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 135872100 |
| Molecular Formula | C23H25FN4O5 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCc1nnc(-c2ccc(OCc3cccc(F)c3)c(OC)c2)[nH]c1=O |
| InChI | InChI=1S/C23H25FN4O5/c1-31-11-10-25-21(29)9-7-18-23(30)26-22(28-27-18)16-6-8-19(20(13-16)32-2)33-14-15-4-3-5-17(24)12-15/h3-6,8,12-13H,7,9-11,14H2,1-2H3,(H,25,29)(H,26,28,30) |
| InChIKey | XTJIITYLZGYDKX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|