C19H26N4O4 — CID 135871939
3-[3-(3-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 135871939) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[3-(3-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[3-(3-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 135871939 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-[3-(3-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | CCCCOc1cccc(-c2nnc(CCC(=O)NCCOC)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H26N4O4/c1-3-4-11-27-15-7-5-6-14(13-15)18-21-19(25)16(22-23-18)8-9-17(24)20-10-12-26-2/h5-7,13H,3-4,8-12H2,1-2H3,(H,20,24)(H,21,23,25) |
| InChIKey | UQYQNVJKLYLVJD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|