C24H25F3N4O3 — CID 135859131
3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 135859131) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 135859131 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CCCCOc1ccc(-c2nnc(CCC(=O)NCc3cccc(C(F)(F)F)c3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C24H25F3N4O3/c1-2-3-13-34-19-9-7-17(8-10-19)22-29-23(33)20(30-31-22)11-12-21(32)28-15-16-5-4-6-18(14-16)24(25,26)27/h4-10,14H,2-3,11-13,15H2,1H3,(H,28,32)(H,29,31,33) |
| InChIKey | PKAIWHYKNFIWHF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|