C25H30N4O4 — CID 135868306
3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[2-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 135868306) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[2-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[2-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 135868306 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[2-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | CCCCOc1ccc(-c2nnc(CCC(=O)NCCc3ccccc3OC)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-3-4-17-33-20-11-9-19(10-12-20)24-27-25(31)21(28-29-24)13-14-23(30)26-16-15-18-7-5-6-8-22(18)32-2/h5-12H,3-4,13-17H2,1-2H3,(H,26,30)(H,27,29,31) |
| InChIKey | IKQRECHWERXHHO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|