C23H25FN4O3 — CID 135871767
3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[(2-fluorophenyl)methyl]propanamide (PubChem CID 135871767) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[(2-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[(2-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 135871767 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-[(2-fluorophenyl)methyl]propanamide |
| SMILES | CCCCOc1ccc(-c2nnc(CCC(=O)NCc3ccccc3F)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H25FN4O3/c1-2-3-14-31-18-10-8-16(9-11-18)22-26-23(30)20(27-28-22)12-13-21(29)25-15-17-6-4-5-7-19(17)24/h4-11H,2-3,12-15H2,1H3,(H,25,29)(H,26,28,30) |
| InChIKey | ULQZALZTLAMDCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|