C22H23N5O3 — CID 135868385
3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 135868385) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 135868385 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | C=CCCOc1ccc(-c2nnc(CCC(=O)NCc3ccccn3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C22H23N5O3/c1-2-3-14-30-18-9-7-16(8-10-18)21-25-22(29)19(26-27-21)11-12-20(28)24-15-17-6-4-5-13-23-17/h2,4-10,13H,1,3,11-12,14-15H2,(H,24,28)(H,25,27,29) |
| InChIKey | RHAKQVRFOUHTQL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|