C20H26N4O3 — CID 135868375
N-butan-2-yl-3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide (PubChem CID 135868375) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-butan-2-yl-3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide.
| Compound Name | N-butan-2-yl-3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
|---|---|
| PubChem CID | 135868375 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-butan-2-yl-3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| SMILES | C=CCCOc1ccc(-c2nnc(CCC(=O)NC(C)CC)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-6-13-27-16-9-7-15(8-10-16)19-22-20(26)17(23-24-19)11-12-18(25)21-14(3)5-2/h4,7-10,14H,1,5-6,11-13H2,2-3H3,(H,21,25)(H,22,24,26) |
| InChIKey | HWGFSMWLVOJSLV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|