C23H31N5O3 — CID 135859214
3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide (PubChem CID 135859214) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide.
| Compound Name | 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 135859214 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 3-[3-(4-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-(2-piperidin-1-ylethyl)propanamide |
| SMILES | C=CCCOc1ccc(-c2nnc(CCC(=O)NCCN3CCCCC3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H31N5O3/c1-2-3-17-31-19-9-7-18(8-10-19)22-25-23(30)20(26-27-22)11-12-21(29)24-13-16-28-14-5-4-6-15-28/h2,7-10H,1,3-6,11-17H2,(H,24,29)(H,25,27,30) |
| InChIKey | BYALKLCYVFFMRQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|