C16H20N4O5S — CID 135872475
N-(2-methoxyethyl)-3-[3-(4-methylsulfonylphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide (PubChem CID 135872475) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[3-(4-methylsulfonylphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[3-(4-methylsulfonylphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
|---|---|
| PubChem CID | 135872475 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-[3-(4-methylsulfonylphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| SMILES | COCCNC(=O)CCc1nnc(-c2ccc(S(C)(=O)=O)cc2)[nH]c1=O |
| InChI | InChI=1S/C16H20N4O5S/c1-25-10-9-17-14(21)8-7-13-16(22)18-15(20-19-13)11-3-5-12(6-4-11)26(2,23)24/h3-6H,7-10H2,1-2H3,(H,17,21)(H,18,20,22) |
| InChIKey | BCVFWZLNSBTWOC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|