C21H28N4O4 — CID 135871818
N-cyclohexyl-3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide (PubChem CID 135871818) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-cyclohexyl-3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide.
| Compound Name | N-cyclohexyl-3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
|---|---|
| PubChem CID | 135871818 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-cyclohexyl-3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| SMILES | COCCOc1ccc(-c2nnc(CCC(=O)NC3CCCCC3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H28N4O4/c1-28-13-14-29-17-9-7-15(8-10-17)20-23-21(27)18(24-25-20)11-12-19(26)22-16-5-3-2-4-6-16/h7-10,16H,2-6,11-14H2,1H3,(H,22,26)(H,23,25,27) |
| InChIKey | NXFCNYGOTXVOAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|