C23H30N4O6 — CID 135868346
ethyl 1-[3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate (PubChem CID 135868346) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is ethyl 1-[3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 135868346 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethyl 1-[3-[3-[4-(2-methoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CCc2nnc(-c3ccc(OCCOC)cc3)[nH]c2=O)C1 |
| InChI | InChI=1S/C23H30N4O6/c1-3-32-23(30)17-5-4-12-27(15-17)20(28)11-10-19-22(29)24-21(26-25-19)16-6-8-18(9-7-16)33-14-13-31-2/h6-9,17H,3-5,10-15H2,1-2H3,(H,24,26,29) |
| InChIKey | USAFRJHKSIGZNE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|