C24H30N4O5 — CID 136836931
ethyl (3R)-1-[3-[3-(3-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate (PubChem CID 136836931) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is ethyl (3R)-1-[3-[3-(3-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[3-[3-(3-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 136836931 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | ethyl (3R)-1-[3-[3-(3-but-3-enoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
| SMILES | C=CCCOc1cccc(-c2nnc(CCC(=O)N3CCC[C@@H](C(=O)OCC)C3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C24H30N4O5/c1-3-5-14-33-19-10-6-8-17(15-19)22-25-23(30)20(26-27-22)11-12-21(29)28-13-7-9-18(16-28)24(31)32-4-2/h3,6,8,10,15,18H,1,4-5,7,9,11-14,16H2,2H3,(H,25,27,30)/t18-/m1/s1 |
| InChIKey | NZPKJUWLROJVPP-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|