C28H34N4O4 — CID 135871942
6-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-3-[3-(2-ethoxyethoxy)phenyl]-4H-1,2,4-triazin-5-one (PubChem CID 135871942) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 6-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-3-[3-(2-ethoxyethoxy)phenyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-3-[3-(2-ethoxyethoxy)phenyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135871942 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 6-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-3-[3-(2-ethoxyethoxy)phenyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCOCCOc1cccc(-c2nnc(CCC(=O)N3CCC(Cc4ccccc4)CC3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C28H34N4O4/c1-2-35-17-18-36-24-10-6-9-23(20-24)27-29-28(34)25(30-31-27)11-12-26(33)32-15-13-22(14-16-32)19-21-7-4-3-5-8-21/h3-10,20,22H,2,11-19H2,1H3,(H,29,31,34) |
| InChIKey | WMMULNOLBYBQJH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|