C22H27N5O5 — CID 135871909
ethyl 4-[3-[5-oxo-3-(3-prop-2-enoxyphenyl)-4H-1,2,4-triazin-6-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 135871909) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is ethyl 4-[3-[5-oxo-3-(3-prop-2-enoxyphenyl)-4H-1,2,4-triazin-6-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[5-oxo-3-(3-prop-2-enoxyphenyl)-4H-1,2,4-triazin-6-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135871909 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethyl 4-[3-[5-oxo-3-(3-prop-2-enoxyphenyl)-4H-1,2,4-triazin-6-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | C=CCOc1cccc(-c2nnc(CCC(=O)N3CCN(C(=O)OCC)CC3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C22H27N5O5/c1-3-14-32-17-7-5-6-16(15-17)20-23-21(29)18(24-25-20)8-9-19(28)26-10-12-27(13-11-26)22(30)31-4-2/h3,5-7,15H,1,4,8-14H2,2H3,(H,23,25,29) |
| InChIKey | NHFZNPWGAGYJHM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|