C21H28N4O4 — CID 135859152
3-[4-(2-ethoxyethoxy)phenyl]-6-(3-oxo-3-piperidin-1-ylpropyl)-4H-1,2,4-triazin-5-one (PubChem CID 135859152) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[4-(2-ethoxyethoxy)phenyl]-6-(3-oxo-3-piperidin-1-ylpropyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[4-(2-ethoxyethoxy)phenyl]-6-(3-oxo-3-piperidin-1-ylpropyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135859152 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[4-(2-ethoxyethoxy)phenyl]-6-(3-oxo-3-piperidin-1-ylpropyl)-4H-1,2,4-triazin-5-one |
| SMILES | CCOCCOc1ccc(-c2nnc(CCC(=O)N3CCCCC3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H28N4O4/c1-2-28-14-15-29-17-8-6-16(7-9-17)20-22-21(27)18(23-24-20)10-11-19(26)25-12-4-3-5-13-25/h6-9H,2-5,10-15H2,1H3,(H,22,24,27) |
| InChIKey | LFDPQURXCJYYAK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|