C24H32N4O5 — CID 136836789
ethyl (3S)-1-[3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate (PubChem CID 136836789) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl (3S)-1-[3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 136836789 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | ethyl (3S)-1-[3-[3-(4-butoxyphenyl)-5-oxo-4H-1,2,4-triazin-6-yl]propanoyl]piperidine-3-carboxylate |
| SMILES | CCCCOc1ccc(-c2nnc(CCC(=O)N3CCC[C@H](C(=O)OCC)C3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C24H32N4O5/c1-3-5-15-33-19-10-8-17(9-11-19)22-25-23(30)20(26-27-22)12-13-21(29)28-14-6-7-18(16-28)24(31)32-4-2/h8-11,18H,3-7,12-16H2,1-2H3,(H,25,27,30)/t18-/m0/s1 |
| InChIKey | KMDYSOZHCQMVGS-SFHVURJKSA-N |
| XLogP | 2.75 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|