C12H19N5O — CID 135875006
4-methyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide (PubChem CID 135875006) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-methyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 135875006 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 4-methyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide |
| SMILES | Cc1cc(=O)[nH]c(N=C(N)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C12H19N5O/c1-8-3-5-17(6-4-8)11(13)16-12-14-9(2)7-10(18)15-12/h7-8H,3-6H2,1-2H3,(H3,13,14,15,16,18) |
| InChIKey | JOTUJXSWRPNVNP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|