C19H22ClN5O2S — CID 135875191
[4-[2-(3-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride (PubChem CID 135875191) has the molecular formula C19H22ClN5O2S and a molecular weight of 419.94 g/mol. Its IUPAC name is [4-[2-(3-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride.
| Compound Name | [4-[2-(3-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 135875191 |
| Molecular Formula | C19H22ClN5O2S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [4-[2-(3-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
| SMILES | COc1cccc(/N=C2/NN=C(c3c[nH]c(C(=O)N4CCCC4)c3)CS2)c1.Cl |
| InChI | InChI=1S/C19H21N5O2S.ClH/c1-26-15-6-4-5-14(10-15)21-19-23-22-17(12-27-19)13-9-16(20-11-13)18(25)24-7-2-3-8-24;/h4-6,9-11,20H,2-3,7-8,12H2,1H3,(H,21,23);1H |
| InChIKey | ZBYZRFNLCUAYTK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|