C20H19BrN2O5 — CID 135875612
6-bromo-3-hydroxy-4-[[3-hydroxy-4-(2-methoxyethoxy)phenyl]methyliminomethyl]-2H-isoquinolin-1-one (PubChem CID 135875612) has the molecular formula C20H19BrN2O5 and a molecular weight of 447.29 g/mol. Its IUPAC name is 6-bromo-3-hydroxy-4-[[3-hydroxy-4-(2-methoxyethoxy)phenyl]methyliminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 6-bromo-3-hydroxy-4-[[3-hydroxy-4-(2-methoxyethoxy)phenyl]methyliminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135875612 |
| Molecular Formula | C20H19BrN2O5 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 6-bromo-3-hydroxy-4-[[3-hydroxy-4-(2-methoxyethoxy)phenyl]methyliminomethyl]-2H-isoquinolin-1-one |
| SMILES | COCCOc1ccc(C/N=C/c2c(O)[nH]c(=O)c3ccc(Br)cc23)cc1O |
| InChI | InChI=1S/C20H19BrN2O5/c1-27-6-7-28-18-5-2-12(8-17(18)24)10-22-11-16-15-9-13(21)3-4-14(15)19(25)23-20(16)26/h2-5,8-9,11,24H,6-7,10H2,1H3,(H2,23,25,26)/b22-11+ |
| InChIKey | UFBHENCIFUXBTB-SSDVNMTOSA-N |
| XLogP | 3.35 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|