C21H19BrN4O5 — CID 136592340
[2-acetamido-5-[[(2-amino-6-bromo-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]methyl]phenyl] acetate (PubChem CID 136592340) has the molecular formula C21H19BrN4O5 and a molecular weight of 487.31 g/mol. Its IUPAC name is [2-acetamido-5-[[(2-amino-6-bromo-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]methyl]phenyl] acetate.
| Compound Name | [2-acetamido-5-[[(2-amino-6-bromo-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 136592340 |
| Molecular Formula | C21H19BrN4O5 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [2-acetamido-5-[[(2-amino-6-bromo-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]methyl]phenyl] acetate |
| SMILES | CC(=O)Nc1ccc(C/N=C/c2c(O)n(N)c(=O)c3ccc(Br)cc23)cc1OC(C)=O |
| InChI | InChI=1S/C21H19BrN4O5/c1-11(27)25-18-6-3-13(7-19(18)31-12(2)28)9-24-10-17-16-8-14(22)4-5-15(16)20(29)26(23)21(17)30/h3-8,10,30H,9,23H2,1-2H3,(H,25,27)/b24-10+ |
| InChIKey | OBQSEMJIZHTRAM-YSURURNPSA-N |
| XLogP | 2.69 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|