C13H16N4O — CID 135880045
3-(4-tert-butylanilino)-4H-1,2,4-triazin-5-one (PubChem CID 135880045) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(4-tert-butylanilino)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-tert-butylanilino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135880045 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(4-tert-butylanilino)-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1ccc(Nc2nncc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H16N4O/c1-13(2,3)9-4-6-10(7-5-9)15-12-16-11(18)8-14-17-12/h4-8H,1-3H3,(H2,15,16,17,18) |
| InChIKey | OZRGPCNNNSNGOE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |