C12H15N5O — CID 135561248
6-tert-butyl-3-(pyridin-3-ylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135561248) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 6-tert-butyl-3-(pyridin-3-ylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3-(pyridin-3-ylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135561248 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 6-tert-butyl-3-(pyridin-3-ylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1nnc(Nc2cccnc2)[nH]c1=O |
| InChI | InChI=1S/C12H15N5O/c1-12(2,3)9-10(18)15-11(17-16-9)14-8-5-4-6-13-7-8/h4-7H,1-3H3,(H2,14,15,17,18) |
| InChIKey | TZLTURVCPVIAQE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |