C14H18N4O — CID 135416785
6-tert-butyl-3-(2-methylanilino)-4H-1,2,4-triazin-5-one (PubChem CID 135416785) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-tert-butyl-3-(2-methylanilino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3-(2-methylanilino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135416785 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 6-tert-butyl-3-(2-methylanilino)-4H-1,2,4-triazin-5-one |
| SMILES | Cc1ccccc1Nc1nnc(C(C)(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C14H18N4O/c1-9-7-5-6-8-10(9)15-13-16-12(19)11(17-18-13)14(2,3)4/h5-8H,1-4H3,(H2,15,16,18,19) |
| InChIKey | WITHUQABBXVZFD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |