C10H10N4O2 — CID 135515938
3-(2-hydroxyanilino)-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135515938) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-(2-hydroxyanilino)-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2-hydroxyanilino)-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135515938 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-(2-hydroxyanilino)-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(Nc2ccccc2O)[nH]c1=O |
| InChI | InChI=1S/C10H10N4O2/c1-6-9(16)12-10(14-13-6)11-7-4-2-3-5-8(7)15/h2-5,15H,1H3,(H2,11,12,14,16) |
| InChIKey | ZPAKDBICYBWQCL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|