C8H8N4S — CID 2725837
5-methyl-N-pyridin-3-yl-1,3,4-thiadiazol-2-amine (PubChem CID 2725837) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 5-methyl-N-pyridin-3-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-methyl-N-pyridin-3-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 2725837 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-methyl-N-pyridin-3-yl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(Nc2cccnc2)s1 |
| InChI | InChI=1S/C8H8N4S/c1-6-11-12-8(13-6)10-7-3-2-4-9-5-7/h2-5H,1H3,(H,10,12) |
| InChIKey | QUILENUBGDVVEW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |