C10H14N2O3 — CID 135881426
2-tert-butyl-4-methyl-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 135881426) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-tert-butyl-4-methyl-6-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 135881426 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C10H14N2O3/c1-5-6(8(14)15)7(13)12-9(11-5)10(2,3)4/h1-4H3,(H,14,15)(H,11,12,13) |
| InChIKey | CQQUJYBDIREBBN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |