C16H25ClN4O2 — CID 137052388
5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-tert-butyl-4-methyl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 137052388) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-tert-butyl-4-methyl-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-tert-butyl-4-methyl-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 137052388 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-tert-butyl-4-methyl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-9-12(13(21)19-15(18-9)16(2,3)4)14(22)20-7-10-5-17-6-11(10)8-20;/h10-11,17H,5-8H2,1-4H3,(H,18,19,21);1H/t10-,11+; |
| InChIKey | NLRPXEDVPSTFBX-NJJJQDLFSA-N |
| XLogP | 1.09 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |