C14H12N2O5 — CID 135883086
2-hydroxy-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzamide (PubChem CID 135883086) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135883086 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-hydroxy-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(O)c(O)c1O)c1ccccc1O |
| InChI | InChI=1S/C14H12N2O5/c17-10-4-2-1-3-9(10)14(21)16-15-7-8-5-6-11(18)13(20)12(8)19/h1-7,17-20H,(H,16,21)/b15-7+ |
| InChIKey | QCYYBXWTRITALG-VIZOYTHASA-N |
| XLogP | 1.27 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|