C20H21N3O3 — CID 135883396
2-(4-ethylphenoxy)-N-[(2-hydroxy-6,7-dimethyl-1H-indol-3-yl)imino]acetamide (PubChem CID 135883396) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[(2-hydroxy-6,7-dimethyl-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[(2-hydroxy-6,7-dimethyl-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 135883396 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[(2-hydroxy-6,7-dimethyl-1H-indol-3-yl)imino]acetamide |
| SMILES | CCc1ccc(OCC(=O)/N=N/c2c(O)[nH]c3c(C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-4-14-6-8-15(9-7-14)26-11-17(24)22-23-19-16-10-5-12(2)13(3)18(16)21-20(19)25/h5-10,21,25H,4,11H2,1-3H3/b23-22+ |
| InChIKey | ADEGLSUJAZATEL-GHVJWSGMSA-N |
| XLogP | 4.74 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|