C19H19N3O3 — CID 3566388
N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(4-methylphenoxy)acetamide (PubChem CID 3566388) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 3566388 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)/N=N/c2c(O)[nH]c3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-11-4-6-14(7-5-11)25-10-16(23)21-22-18-15-9-12(2)8-13(3)17(15)20-19(18)24/h4-9,20,24H,10H2,1-3H3/b22-21+ |
| InChIKey | KSYFLEHMIPMHJE-QURGRASLSA-N |
| XLogP | 4.49 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|