C12H14N4OS — CID 135758806
1-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-3-methylthiourea (PubChem CID 135758806) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-3-methylthiourea.
| Compound Name | 1-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-3-methylthiourea |
|---|---|
| PubChem CID | 135758806 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-3-methylthiourea |
| SMILES | CNC(=S)/N=N/c1c(O)[nH]c2c(C)cc(C)cc12 |
| InChI | InChI=1S/C12H14N4OS/c1-6-4-7(2)9-8(5-6)10(11(17)14-9)15-16-12(18)13-3/h4-5,14,17H,1-3H3,(H,13,18)/b16-15+ |
| InChIKey | FQOVEYHJRHHPIU-FOCLMDBBSA-N |
| XLogP | 3.08 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|