C17H22N4OS — CID 135816182
1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 135816182) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 135816182 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(2-hydroxy-7-methyl-1H-indol-3-yl)imino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | Cc1cccc2c(/N=N/C(=S)N[C@@H]3CCCC[C@@H]3C)c(O)[nH]c12 |
| InChI | InChI=1S/C17H22N4OS/c1-10-6-3-4-9-13(10)18-17(23)21-20-15-12-8-5-7-11(2)14(12)19-16(15)22/h5,7-8,10,13,19,22H,3-4,6,9H2,1-2H3,(H,18,23)/b21-20+/t10-,13+/m0/s1 |
| InChIKey | GWYWVDGBPGRBJE-JJIRCQGVSA-N |
| XLogP | 4.72 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|