C21H17N3O5 — CID 137179326
N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 137179326) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 137179326 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(C)c2[nH]c(O)c(/N=N/C(=O)COc3ccc4ccc(=O)oc4c3)c2c1 |
| InChI | InChI=1S/C21H17N3O5/c1-11-7-12(2)19-15(8-11)20(21(27)22-19)24-23-17(25)10-28-14-5-3-13-4-6-18(26)29-16(13)9-14/h3-9,22,27H,10H2,1-2H3/b24-23+ |
| InChIKey | GNUHCRSCGJJYSM-WCWDXBQESA-N |
| XLogP | 4.29 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|