C21H20N6O3S — CID 135884032
2-[[6-[(4-methoxyphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 135884032) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-[[6-[(4-methoxyphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[6-[(4-methoxyphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135884032 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[[6-[(4-methoxyphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1ccc(Cc2nn3c(SCC(=O)Nc4ccccc4C)nnc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H20N6O3S/c1-13-5-3-4-6-16(13)22-18(28)12-31-21-25-24-20-23-19(29)17(26-27(20)21)11-14-7-9-15(30-2)10-8-14/h3-10H,11-12H2,1-2H3,(H,22,28)(H,23,24,29) |
| InChIKey | GVSMQWYHNSUBPR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |