C21H17F3N6O2S — CID 135906706
2-[[6-[(4-methylphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 135906706) has the molecular formula C21H17F3N6O2S and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-[[6-[(4-methylphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[6-[(4-methylphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135906706 |
| Molecular Formula | C21H17F3N6O2S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[[6-[(4-methylphenyl)methyl]-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(Cc2nn3c(SCC(=O)Nc4ccccc4C(F)(F)F)nnc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H17F3N6O2S/c1-12-6-8-13(9-7-12)10-16-18(32)26-19-27-28-20(30(19)29-16)33-11-17(31)25-15-5-3-2-4-14(15)21(22,23)24/h2-9H,10-11H2,1H3,(H,25,31)(H,26,27,32) |
| InChIKey | NNKJLJXOXRHDHN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |