C19H16N6O4 — CID 135884531
2-amino-7-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-1H-purin-6-one (PubChem CID 135884531) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-amino-7-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-1H-purin-6-one.
| Compound Name | 2-amino-7-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135884531 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-amino-7-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]-1H-purin-6-one |
| SMILES | COc1ccc(Cn2cnc3nc(N)[nH]c(=O)c32)cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N6O4/c1-29-15-6-5-11(7-14(15)12-3-2-4-13(8-12)25(27)28)9-24-10-21-17-16(24)18(26)23-19(20)22-17/h2-8,10H,9H2,1H3,(H3,20,22,23,26) |
| InChIKey | UAXIWMGAFYMYHM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|