C23H23N3O8S — CID 135884658
dimethyl 5-[[(6R)-2-(2,5-dimethoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzene-1,3-dicarboxylate (PubChem CID 135884658) has the molecular formula C23H23N3O8S and a molecular weight of 501.52 g/mol. Its IUPAC name is dimethyl 5-[[(6R)-2-(2,5-dimethoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(6R)-2-(2,5-dimethoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135884658 |
| Molecular Formula | C23H23N3O8S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | dimethyl 5-[[(6R)-2-(2,5-dimethoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@H]2CC(=O)N/C(=N/c3cc(OC)ccc3OC)S2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H23N3O8S/c1-31-15-5-6-17(32-2)16(10-15)25-23-26-19(27)11-18(35-23)20(28)24-14-8-12(21(29)33-3)7-13(9-14)22(30)34-4/h5-10,18H,11H2,1-4H3,(H,24,28)(H,25,26,27)/t18-/m1/s1 |
| InChIKey | CRSCQZBANANOIQ-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|