C19H15ClF3N3O3S — CID 136883054
(6R)-2-(5-chloro-2-methoxyphenyl)imino-4-oxo-N-[2-(trifluoromethyl)phenyl]-1,3-thiazinane-6-carboxamide (PubChem CID 136883054) has the molecular formula C19H15ClF3N3O3S and a molecular weight of 457.86 g/mol. Its IUPAC name is (6R)-2-(5-chloro-2-methoxyphenyl)imino-4-oxo-N-[2-(trifluoromethyl)phenyl]-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-2-(5-chloro-2-methoxyphenyl)imino-4-oxo-N-[2-(trifluoromethyl)phenyl]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 136883054 |
| Molecular Formula | C19H15ClF3N3O3S |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (6R)-2-(5-chloro-2-methoxyphenyl)imino-4-oxo-N-[2-(trifluoromethyl)phenyl]-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(Cl)cc1/N=C1/NC(=O)C[C@H](C(=O)Nc2ccccc2C(F)(F)F)S1 |
| InChI | InChI=1S/C19H15ClF3N3O3S/c1-29-14-7-6-10(20)8-13(14)25-18-26-16(27)9-15(30-18)17(28)24-12-5-3-2-4-11(12)19(21,22)23/h2-8,15H,9H2,1H3,(H,24,28)(H,25,26,27)/t15-/m1/s1 |
| InChIKey | LBRNRLCWICVFDP-OAHLLOKOSA-N |
| XLogP | 4.62 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|